C18H22N2O3 — CID 5196839
2-hydroxy-N'-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzohydrazide (PubChem CID 5196839) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-hydroxy-N'-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzohydrazide |
|---|---|
| PubChem CID | 5196839 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-hydroxy-N'-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]benzohydrazide |
| SMILES | CC12CCC(C(=CNNC(=O)c3ccccc3O)C1=O)C2(C)C |
| InChI | InChI=1S/C18H22N2O3/c1-17(2)13-8-9-18(17,3)15(22)12(13)10-19-20-16(23)11-6-4-5-7-14(11)21/h4-7,10,13,19,21H,8-9H2,1-3H3,(H,20,23) |
| InChIKey | XVSVGDUDXXFFJQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|