C8H7F2N5 — CID 51976278
(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methanamine (PubChem CID 51976278) has the molecular formula C8H7F2N5 and a molecular weight of 211.18 g/mol. Its IUPAC name is (S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methanamine.
| Compound Name | (S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 51976278 |
| Molecular Formula | C8H7F2N5 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methanamine |
| SMILES | N[C@H](c1nn[nH]n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H7F2N5/c9-4-1-2-6(10)5(3-4)7(11)8-12-14-15-13-8/h1-3,7H,11H2,(H,12,13,14,15)/t7-/m0/s1 |
| InChIKey | ZKFFTZYMHYAPKV-ZETCQYMHSA-N |
| XLogP | 0.53 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |