C10H13N5O2 — CID 61149610
(2,5-dimethoxyphenyl)-(2H-tetrazol-5-yl)methanamine (PubChem CID 61149610) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-(2H-tetrazol-5-yl)methanamine.
| Compound Name | (2,5-dimethoxyphenyl)-(2H-tetrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 61149610 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2,5-dimethoxyphenyl)-(2H-tetrazol-5-yl)methanamine |
| SMILES | COc1ccc(OC)c(C(N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H13N5O2/c1-16-6-3-4-8(17-2)7(5-6)9(11)10-12-14-15-13-10/h3-5,9H,11H2,1-2H3,(H,12,13,14,15) |
| InChIKey | LAUKVIMJZZUEPH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |