C11H15N5O3 — CID 61149467
2H-tetrazol-5-yl-(2,4,6-trimethoxyphenyl)methanamine (PubChem CID 61149467) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2H-tetrazol-5-yl-(2,4,6-trimethoxyphenyl)methanamine.
| Compound Name | 2H-tetrazol-5-yl-(2,4,6-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 61149467 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2H-tetrazol-5-yl-(2,4,6-trimethoxyphenyl)methanamine |
| SMILES | COc1cc(OC)c(C(N)c2nn[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C11H15N5O3/c1-17-6-4-7(18-2)9(8(5-6)19-3)10(12)11-13-15-16-14-11/h4-5,10H,12H2,1-3H3,(H,13,14,15,16) |
| InChIKey | QKQTVVWDHRHHBO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |