About 2-amino-7,8-dihydro-6H-quinazolin-5-one
2-amino-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 5200220) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-amino-7,8-dihydro-6H-quinazolin-5-one.
Molecular Properties
| Compound Name | 2-amino-7,8-dihydro-6H-quinazolin-5-one |
| PubChem CID | 5200220 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-amino-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | Nc1ncc2c(n1)CCCC2=O |
| InChI | InChI=1S/C8H9N3O/c9-8-10-4-5-6(11-8)2-1-3-7(5)12/h4H,1-3H2,(H2,9,10,11) |
| InChIKey | ZXWJMLMXKMSYTP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7,8-dihydro-6H-quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,8-dihydro-6H-quinazolin-5-one?
The IUPAC name of 2-amino-7,8-dihydro-6H-quinazolin-5-one (CID 5200220) is 2-amino-7,8-dihydro-6H-quinazolin-5-one.
What is the SMILES notation for 2-amino-7,8-dihydro-6H-quinazolin-5-one?
The canonical SMILES for 2-amino-7,8-dihydro-6H-quinazolin-5-one is Nc1ncc2c(n1)CCCC2=O.
What is the InChIKey of 2-amino-7,8-dihydro-6H-quinazolin-5-one?
The InChIKey is ZXWJMLMXKMSYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-8-10-4-5-6(11-8)2-1-3-7(5)12/h4H,1-3H2,(H2,9,10,11).
What are the key properties of 2-amino-7,8-dihydro-6H-quinazolin-5-one?
2-amino-7,8-dihydro-6H-quinazolin-5-one has a molecular weight of 163.18 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,8-dihydro-6H-quinazolin-5-one is sourced from PubChem (CID 5200220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).