C9H11N3O — CID 3426161
2-amino-7-methyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 3426161) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-amino-7-methyl-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-amino-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 3426161 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-amino-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | CC1CC(=O)c2cnc(N)nc2C1 |
| InChI | InChI=1S/C9H11N3O/c1-5-2-7-6(8(13)3-5)4-11-9(10)12-7/h4-5H,2-3H2,1H3,(H2,10,11,12) |
| InChIKey | JZVAVPSXDGOXIX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |