C10H13N3O — CID 3137930
4-amino-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 3137930) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-amino-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 4-amino-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 3137930 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-amino-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(N)ncnc2C1 |
| InChI | InChI=1S/C10H13N3O/c1-10(2)3-6-8(7(14)4-10)9(11)13-5-12-6/h5H,3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | DYPFWRCGECJCBK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |