C15H12INO3 — CID 5200268
(6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(3-iodophenyl)methanone (PubChem CID 5200268) has the molecular formula C15H12INO3 and a molecular weight of 381.17 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(3-iodophenyl)methanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 5200268 |
| Molecular Formula | C15H12INO3 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzodioxin-7-yl)-(3-iodophenyl)methanone |
| SMILES | Nc1cc2c(cc1C(=O)c1cccc(I)c1)OCCO2 |
| InChI | InChI=1S/C15H12INO3/c16-10-3-1-2-9(6-10)15(18)11-7-13-14(8-12(11)17)20-5-4-19-13/h1-3,6-8H,4-5,17H2 |
| InChIKey | GCPIEQGRZRNYSZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|