C10H12N6S2 — CID 5214173
(5-methyl-1,3,4-thiadiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate (PubChem CID 5214173) has the molecular formula C10H12N6S2 and a molecular weight of 280.38 g/mol. Its IUPAC name is (5-methyl-1,3,4-thiadiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate.
| Compound Name | (5-methyl-1,3,4-thiadiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate |
|---|---|
| PubChem CID | 5214173 |
| Molecular Formula | C10H12N6S2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (5-methyl-1,3,4-thiadiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate |
| SMILES | Cc1cc(C)nc(N=C(N)Sc2nnc(C)s2)n1 |
| InChI | InChI=1S/C10H12N6S2/c1-5-4-6(2)13-9(12-5)14-8(11)18-10-16-15-7(3)17-10/h4H,1-3H3,(H2,11,12,13,14) |
| InChIKey | WPPVKINZQYQIFF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|