C16H17N5OS2 — CID 46861504
(6-ethoxy-1,3-benzothiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate (PubChem CID 46861504) has the molecular formula C16H17N5OS2 and a molecular weight of 359.48 g/mol. Its IUPAC name is (6-ethoxy-1,3-benzothiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate.
| Compound Name | (6-ethoxy-1,3-benzothiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate |
|---|---|
| PubChem CID | 46861504 |
| Molecular Formula | C16H17N5OS2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (6-ethoxy-1,3-benzothiazol-2-yl) N'-(4,6-dimethylpyrimidin-2-yl)carbamimidothioate |
| SMILES | CCOc1ccc2nc(S/C(N)=N/c3nc(C)cc(C)n3)sc2c1 |
| InChI | InChI=1S/C16H17N5OS2/c1-4-22-11-5-6-12-13(8-11)23-16(20-12)24-14(17)21-15-18-9(2)7-10(3)19-15/h5-8H,4H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | PFBJFMJOJNTABW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|