C16H12N2OS2 — CID 54540083
4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]benzonitrile (PubChem CID 54540083) has the molecular formula C16H12N2OS2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 54540083 |
| Molecular Formula | C16H12N2OS2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]benzonitrile |
| SMILES | CCOc1ccc2nc(Sc3ccc(C#N)cc3)sc2c1 |
| InChI | InChI=1S/C16H12N2OS2/c1-2-19-12-5-8-14-15(9-12)21-16(18-14)20-13-6-3-11(10-17)4-7-13/h3-9H,2H2,1H3 |
| InChIKey | ZCNWVKCKLQYCRM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |