C26H26FN3O4 — CID 5224630
3,4,5-triethoxy-N-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]benzamide (PubChem CID 5224630) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 5224630 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2c(-c3ccc(F)cc3)nc3ccccn23)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H26FN3O4/c1-4-32-20-15-18(16-21(33-5-2)24(20)34-6-3)26(31)29-25-23(17-10-12-19(27)13-11-17)28-22-9-7-8-14-30(22)25/h7-16H,4-6H2,1-3H3,(H,29,31) |
| InChIKey | AEWIWCJWAGXGKR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |