C23H36N2O5 — CID 5224778
8-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-17-oxa-6-azaspiro[4.13]octadec-10-ene-7,16-dione (PubChem CID 5224778) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is 8-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-17-oxa-6-azaspiro[4.13]octadec-10-ene-7,16-dione.
| Compound Name | 8-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-17-oxa-6-azaspiro[4.13]octadec-10-ene-7,16-dione |
|---|---|
| PubChem CID | 5224778 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 8-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoethyl]-17-oxa-6-azaspiro[4.13]octadec-10-ene-7,16-dione |
| SMILES | O=C1CCCCC=CCC(CC(=O)N2CCCC2CO)C(=O)NC2(CCCC2)CO1 |
| InChI | InChI=1S/C23H36N2O5/c26-16-19-10-8-14-25(19)20(27)15-18-9-4-2-1-3-5-11-21(28)30-17-23(24-22(18)29)12-6-7-13-23/h2,4,18-19,26H,1,3,5-17H2,(H,24,29) |
| InChIKey | DTCRHKQQQMGEFX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|