C5H6ClN5O — CID 522919
N-[(5-amino-6-chloropyrimidin-4-yl)amino]formamide (PubChem CID 522919) has the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. Its IUPAC name is N-[(5-amino-6-chloropyrimidin-4-yl)amino]formamide.
| Compound Name | N-[(5-amino-6-chloropyrimidin-4-yl)amino]formamide |
|---|---|
| PubChem CID | 522919 |
| Molecular Formula | C5H6ClN5O |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | N-[(5-amino-6-chloropyrimidin-4-yl)amino]formamide |
| SMILES | Nc1c(Cl)ncnc1NNC=O |
| InChI | InChI=1S/C5H6ClN5O/c6-4-3(7)5(9-1-8-4)11-10-2-12/h1-2H,7H2,(H,10,12)(H,8,9,11) |
| InChIKey | LQZGIHUXJKFQDZ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|