C20H11F3N4 — CID 5229657
2-amino-6-(4-cyanophenyl)-4-[2-(trifluoromethyl)phenyl]pyridine-3-carbonitrile (PubChem CID 5229657) has the molecular formula C20H11F3N4 and a molecular weight of 364.33 g/mol. Its IUPAC name is 2-amino-6-(4-cyanophenyl)-4-[2-(trifluoromethyl)phenyl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-cyanophenyl)-4-[2-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5229657 |
| Molecular Formula | C20H11F3N4 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-amino-6-(4-cyanophenyl)-4-[2-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccccc3C(F)(F)F)c(C#N)c(N)n2)cc1 |
| InChI | InChI=1S/C20H11F3N4/c21-20(22,23)17-4-2-1-3-14(17)15-9-18(27-19(26)16(15)11-25)13-7-5-12(10-24)6-8-13/h1-9H,(H2,26,27) |
| InChIKey | OLEGXLLTYXVKGB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |