C24H26O2Pd — CID 5231750
diphenylmethylbenzene;palladium(2+);pentane-2,4-diol (PubChem CID 5231750) has the molecular formula C24H26O2Pd and a molecular weight of 452.89 g/mol. Its IUPAC name is diphenylmethylbenzene;palladium(2+);pentane-2,4-diol.
| Compound Name | diphenylmethylbenzene;palladium(2+);pentane-2,4-diol |
|---|---|
| PubChem CID | 5231750 |
| Molecular Formula | C24H26O2Pd |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | diphenylmethylbenzene;palladium(2+);pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.[Pd+2].[c-]1ccccc1[C-](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14.C5H12O2.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)3-5(2)7;/h1-14H;4-7H,3H2,1-2H3;/q-2;;+2 |
| InChIKey | UPCONQKIVAHLOH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|