About diphenylmethylbenzene;palladium(2+);pentane-2,4-diol
diphenylmethylbenzene;palladium(2+);pentane-2,4-diol (PubChem CID 5231750) has the molecular formula C24H26O2Pd
and a molecular weight of 452.89 g/mol. Its IUPAC name is diphenylmethylbenzene;palladium(2+);pentane-2,4-diol.
Molecular Properties
| Compound Name | diphenylmethylbenzene;palladium(2+);pentane-2,4-diol |
| PubChem CID | 5231750 |
| Molecular Formula | C24H26O2Pd |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | diphenylmethylbenzene;palladium(2+);pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.[Pd+2].[c-]1ccccc1[C-](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14.C5H12O2.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)3-5(2)7;/h1-14H;4-7H,3H2,1-2H3;/q-2;;+2 |
| InChIKey | UPCONQKIVAHLOH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethylbenzene;palladium(2+);pentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethylbenzene;palladium(2+);pentane-2,4-diol?
The IUPAC name of diphenylmethylbenzene;palladium(2+);pentane-2,4-diol (CID 5231750) is diphenylmethylbenzene;palladium(2+);pentane-2,4-diol.
What is the SMILES notation for diphenylmethylbenzene;palladium(2+);pentane-2,4-diol?
The canonical SMILES for diphenylmethylbenzene;palladium(2+);pentane-2,4-diol is CC(O)CC(C)O.[Pd+2].[c-]1ccccc1[C-](c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethylbenzene;palladium(2+);pentane-2,4-diol?
The InChIKey is UPCONQKIVAHLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14.C5H12O2.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)3-5(2)7;/h1-14H;4-7H,3H2,1-2H3;/q-2;;+2.
What are the key properties of diphenylmethylbenzene;palladium(2+);pentane-2,4-diol?
diphenylmethylbenzene;palladium(2+);pentane-2,4-diol has a molecular weight of 452.89 g/mol, XLogP of 4.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethylbenzene;palladium(2+);pentane-2,4-diol is sourced from PubChem (CID 5231750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).