C19H16F5IrN2O3- — CID 59512742
iridium;2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3,4-oxadiazole;pentane-2,4-diol (PubChem CID 59512742) has the molecular formula C19H16F5IrN2O3- and a molecular weight of 607.56 g/mol. Its IUPAC name is iridium;2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3,4-oxadiazole;pentane-2,4-diol.
| Compound Name | iridium;2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3,4-oxadiazole;pentane-2,4-diol |
|---|---|
| PubChem CID | 59512742 |
| Molecular Formula | C19H16F5IrN2O3- |
| Molecular Weight | 607.56 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | iridium;2-(2,3,4,5,6-pentafluorophenyl)-5-phenyl-1,3,4-oxadiazole;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Fc1c(F)c(F)c(-c2nnc(-c3[c-]cccc3)o2)c(F)c1F.[Ir] |
| InChI | InChI=1S/C14H4F5N2O.C5H12O2.Ir/c15-8-7(9(16)11(18)12(19)10(8)17)14-21-20-13(22-14)6-4-2-1-3-5-6;1-4(6)3-5(2)7;/h1-4H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | KZLQHGZFNVHXRF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|