C20H27B2N2O2Pt- — CID 162499312
(2,3-dimethyl-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene)platinum;pentane-2,4-diol (PubChem CID 162499312) has the molecular formula C20H27B2N2O2Pt- and a molecular weight of 544.15 g/mol. Its IUPAC name is (2,3-dimethyl-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene)platinum;pentane-2,4-diol.
| Compound Name | (2,3-dimethyl-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene)platinum;pentane-2,4-diol |
|---|---|
| PubChem CID | 162499312 |
| Molecular Formula | C20H27B2N2O2Pt- |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | (2,3-dimethyl-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene)platinum;pentane-2,4-diol |
| SMILES | CB1B(C)N(c2ccccc2)C(=[Pt])N1c1[c-]cccc1.CC(O)CC(C)O |
| InChI | InChI=1S/C15H15B2N2.C5H12O2.Pt/c1-16-17(2)19(15-11-7-4-8-12-15)13-18(16)14-9-5-3-6-10-14;1-4(6)3-5(2)7;/h3-11H,1-2H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | DEIKURCPICIJAC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|