C16H32N4 — CID 5232197
N-(piperidin-3-ylmethyl)-N'-(1,2,3,6-tetrahydropyridin-3-ylmethyl)butane-1,4-diamine (PubChem CID 5232197) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is N-(piperidin-3-ylmethyl)-N'-(1,2,3,6-tetrahydropyridin-3-ylmethyl)butane-1,4-diamine.
| Compound Name | N-(piperidin-3-ylmethyl)-N'-(1,2,3,6-tetrahydropyridin-3-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 5232197 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | N-(piperidin-3-ylmethyl)-N'-(1,2,3,6-tetrahydropyridin-3-ylmethyl)butane-1,4-diamine |
| SMILES | C1=CC(CNCCCCNCC2CCCNC2)CNC1 |
| InChI | InChI=1S/C16H32N4/c1(7-17-11-15-5-3-9-19-13-15)2-8-18-12-16-6-4-10-20-14-16/h3,5,15-20H,1-2,4,6-14H2 |
| InChIKey | SGRLWGOJACVVEL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|