C18H18N2O6 — CID 5232329
ethyl 6-acetamido-3,5,7-trioxo-1-phenyl-2,8-dihydro-1H-pyrrolizine-2-carboxylate (PubChem CID 5232329) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is ethyl 6-acetamido-3,5,7-trioxo-1-phenyl-2,8-dihydro-1H-pyrrolizine-2-carboxylate.
| Compound Name | ethyl 6-acetamido-3,5,7-trioxo-1-phenyl-2,8-dihydro-1H-pyrrolizine-2-carboxylate |
|---|---|
| PubChem CID | 5232329 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 6-acetamido-3,5,7-trioxo-1-phenyl-2,8-dihydro-1H-pyrrolizine-2-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N2C(=O)C(NC(C)=O)C(=O)C2C1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O6/c1-3-26-18(25)12-11(10-7-5-4-6-8-10)14-15(22)13(19-9(2)21)17(24)20(14)16(12)23/h4-8,11-14H,3H2,1-2H3,(H,19,21) |
| InChIKey | UEDINAFCUUNSEZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|