C18H32N6 — CID 5232409
2,4,6-tri(piperidin-2-yl)-1,4-dihydro-1,3,5-triazine (PubChem CID 5232409) has the molecular formula C18H32N6 and a molecular weight of 332.50 g/mol. Its IUPAC name is 2,4,6-tri(piperidin-2-yl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,4,6-tri(piperidin-2-yl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 5232409 |
| Molecular Formula | C18H32N6 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 2,4,6-tri(piperidin-2-yl)-1,4-dihydro-1,3,5-triazine |
| SMILES | C1CCC(C2=NC(C3CCCCN3)N=C(C3CCCCN3)N2)NC1 |
| InChI | InChI=1S/C18H32N6/c1-4-10-19-13(7-1)16-22-17(14-8-2-5-11-20-14)24-18(23-16)15-9-3-6-12-21-15/h13-16,19-21H,1-12H2,(H,22,23,24) |
| InChIKey | BPYFPDSSNLMVDZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |