C24H60O7Si6 — CID 523383
trimethylsilyl (2S,3S,4S,5S)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanoate (PubChem CID 523383) has the molecular formula C24H60O7Si6 and a molecular weight of 629.25 g/mol. Its IUPAC name is trimethylsilyl (2S,3S,4S,5S)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanoate.
| Compound Name | trimethylsilyl (2S,3S,4S,5S)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanoate |
|---|---|
| PubChem CID | 523383 |
| Molecular Formula | C24H60O7Si6 |
| Molecular Weight | 629.25 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | trimethylsilyl (2S,3S,4S,5S)-2,3,4,5,6-pentakis(trimethylsilyloxy)hexanoate |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H60O7Si6/c1-32(2,3)26-19-20(27-33(4,5)6)21(28-34(7,8)9)22(29-35(10,11)12)23(30-36(13,14)15)24(25)31-37(16,17)18/h20-23H,19H2,1-18H3/t20-,21-,22-,23-/m0/s1 |
| InChIKey | IVIMVRAMMWQMHJ-MLCQCVOFSA-N |
| XLogP | 7.10 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.25 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|