C15H13F5OSi — CID 523435
dimethyl-(2,3,4,5,6-pentafluorophenyl)-phenylmethoxysilane (PubChem CID 523435) has the molecular formula C15H13F5OSi and a molecular weight of 332.34 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-phenylmethoxysilane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-phenylmethoxysilane |
|---|---|
| PubChem CID | 523435 |
| Molecular Formula | C15H13F5OSi |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-phenylmethoxysilane |
| SMILES | C[Si](C)(OCc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H13F5OSi/c1-22(2,21-8-9-6-4-3-5-7-9)15-13(19)11(17)10(16)12(18)14(15)20/h3-7H,8H2,1-2H3 |
| InChIKey | PUJFMMQJFLXFTF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|