C31H29NOPS2+ — CID 5238925
1-diphenylphosphinothioyl-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-ene-2-thiol (PubChem CID 5238925) has the molecular formula C31H29NOPS2+ and a molecular weight of 526.69 g/mol. Its IUPAC name is 1-diphenylphosphinothioyl-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-ene-2-thiol.
| Compound Name | 1-diphenylphosphinothioyl-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-ene-2-thiol |
|---|---|
| PubChem CID | 5238925 |
| Molecular Formula | C31H29NOPS2+ |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 1-diphenylphosphinothioyl-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-ene-2-thiol |
| SMILES | S=P(C(=C(S)C(c1ccccc1)=[N+]1CCOCC1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28NOPS2/c35-31(29(25-13-5-1-6-14-25)32-21-23-33-24-22-32)30(26-15-7-2-8-16-26)34(36,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20H,21-24H2/p+1 |
| InChIKey | AHNDBWBGHSVHKL-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 12.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|