C19H18NO+ — CID 11729581
4-(1,3-diphenylprop-2-ynylidene)morpholin-4-ium (PubChem CID 11729581) has the molecular formula C19H18NO+ and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-(1,3-diphenylprop-2-ynylidene)morpholin-4-ium.
| Compound Name | 4-(1,3-diphenylprop-2-ynylidene)morpholin-4-ium |
|---|---|
| PubChem CID | 11729581 |
| Molecular Formula | C19H18NO+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(1,3-diphenylprop-2-ynylidene)morpholin-4-ium |
| SMILES | C(#Cc1ccccc1)C(c1ccccc1)=[N+]1CCOCC1 |
| InChI | InChI=1S/C19H18NO/c1-3-7-17(8-4-1)11-12-19(18-9-5-2-6-10-18)20-13-15-21-16-14-20/h1-10H,13-16H2/q+1 |
| InChIKey | JAISBROEPKLKKP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|