C20H19F3NO4S+ — CID 10907954
[(E)-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-enyl] trifluoromethanesulfonate (PubChem CID 10907954) has the molecular formula C20H19F3NO4S+ and a molecular weight of 426.44 g/mol. Its IUPAC name is [(E)-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-enyl] trifluoromethanesulfonate.
| Compound Name | [(E)-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10907954 |
| Molecular Formula | C20H19F3NO4S+ |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [(E)-3-morpholin-4-ium-4-ylidene-1,3-diphenylprop-1-enyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/C(=C/C(c1ccccc1)=[N+]1CCOCC1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3NO4S/c21-20(22,23)29(25,26)28-19(17-9-5-2-6-10-17)15-18(16-7-3-1-4-8-16)24-11-13-27-14-12-24/h1-10,15H,11-14H2/q+1/b19-15+ |
| InChIKey | GUDPVRJYCRSRJL-XDJHFCHBSA-N |
| XLogP | 3.43 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|