C15H17F3NO3S+ — CID 10907195
[(E)-1-phenyl-3-piperidin-1-ium-1-ylideneprop-1-enyl] trifluoromethanesulfonate (PubChem CID 10907195) has the molecular formula C15H17F3NO3S+ and a molecular weight of 348.37 g/mol. Its IUPAC name is [(E)-1-phenyl-3-piperidin-1-ium-1-ylideneprop-1-enyl] trifluoromethanesulfonate.
| Compound Name | [(E)-1-phenyl-3-piperidin-1-ium-1-ylideneprop-1-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10907195 |
| Molecular Formula | C15H17F3NO3S+ |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [(E)-1-phenyl-3-piperidin-1-ium-1-ylideneprop-1-enyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/C(=C/C=[N+]1CCCCC1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3NO3S/c16-15(17,18)23(20,21)22-14(13-7-3-1-4-8-13)9-12-19-10-5-2-6-11-19/h1,3-4,7-9,12H,2,5-6,10-11H2/q+1/b14-9+ |
| InChIKey | YWFAUTNOVUXESK-NTEUORMPSA-N |
| XLogP | 3.16 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|