C17H18ClF3NO3S+ — CID 11261473
[(Z)-1-(4-chlorophenyl)-2-(1-prop-2-enyl-2,3,4,5-tetrahydropyridin-1-ium-6-yl)ethenyl] trifluoromethanesulfonate (PubChem CID 11261473) has the molecular formula C17H18ClF3NO3S+ and a molecular weight of 408.85 g/mol. Its IUPAC name is [(Z)-1-(4-chlorophenyl)-2-(1-prop-2-enyl-2,3,4,5-tetrahydropyridin-1-ium-6-yl)ethenyl] trifluoromethanesulfonate.
| Compound Name | [(Z)-1-(4-chlorophenyl)-2-(1-prop-2-enyl-2,3,4,5-tetrahydropyridin-1-ium-6-yl)ethenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11261473 |
| Molecular Formula | C17H18ClF3NO3S+ |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(Z)-1-(4-chlorophenyl)-2-(1-prop-2-enyl-2,3,4,5-tetrahydropyridin-1-ium-6-yl)ethenyl] trifluoromethanesulfonate |
| SMILES | C=CC[N+]1=C(/C=C(\OS(=O)(=O)C(F)(F)F)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C17H18ClF3NO3S/c1-2-10-22-11-4-3-5-15(22)12-16(13-6-8-14(18)9-7-13)25-26(23,24)17(19,20)21/h2,6-9,12H,1,3-5,10-11H2/q+1/b16-12- |
| InChIKey | YTUBIFYOFBPMAA-VBKFSLOCSA-N |
| XLogP | 4.37 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|