C10H8ClF3O — CID 70427275
1-chloro-4-[(Z)-3,3,3-trifluoro-1-methoxyprop-1-enyl]benzene (PubChem CID 70427275) has the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. Its IUPAC name is 1-chloro-4-[(Z)-3,3,3-trifluoro-1-methoxyprop-1-enyl]benzene.
| Compound Name | 1-chloro-4-[(Z)-3,3,3-trifluoro-1-methoxyprop-1-enyl]benzene |
|---|---|
| PubChem CID | 70427275 |
| Molecular Formula | C10H8ClF3O |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-chloro-4-[(Z)-3,3,3-trifluoro-1-methoxyprop-1-enyl]benzene |
| SMILES | CO/C(=C\C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClF3O/c1-15-9(6-10(12,13)14)7-2-4-8(11)5-3-7/h2-6H,1H3/b9-6- |
| InChIKey | ZDZOJTHSSRAWIA-TWGQIWQCSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|