C15H20ClF3Si — CID 25242882
[(E)-1-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-triethylsilane (PubChem CID 25242882) has the molecular formula C15H20ClF3Si and a molecular weight of 320.86 g/mol. Its IUPAC name is [(E)-1-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-triethylsilane.
| Compound Name | [(E)-1-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-triethylsilane |
|---|---|
| PubChem CID | 25242882 |
| Molecular Formula | C15H20ClF3Si |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(E)-1-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)/C(=C/C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClF3Si/c1-4-20(5-2,6-3)14(11-15(17,18)19)12-7-9-13(16)10-8-12/h7-11H,4-6H2,1-3H3/b14-11+ |
| InChIKey | VKRURASHTJRMRH-SDNWHVSQSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|