C9H5ClF3N3 — CID 122231193
1-[(Z)-1-azido-3,3,3-trifluoroprop-1-enyl]-4-chlorobenzene (PubChem CID 122231193) has the molecular formula C9H5ClF3N3 and a molecular weight of 247.61 g/mol. Its IUPAC name is 1-[(Z)-1-azido-3,3,3-trifluoroprop-1-enyl]-4-chlorobenzene.
| Compound Name | 1-[(Z)-1-azido-3,3,3-trifluoroprop-1-enyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 122231193 |
| Molecular Formula | C9H5ClF3N3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 1-[(Z)-1-azido-3,3,3-trifluoroprop-1-enyl]-4-chlorobenzene |
| SMILES | [N-]=[N+]=N/C(=C\C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H5ClF3N3/c10-7-3-1-6(2-4-7)8(15-16-14)5-9(11,12)13/h1-5H/b8-5- |
| InChIKey | XPBSEBFOVDRVGC-YVMONPNESA-N |
| XLogP | 4.55 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|