About 1,2,3,4-tetrahydroquinazoline
1,2,3,4-tetrahydroquinazoline (PubChem CID 5246559) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 1,2,3,4-tetrahydroquinazoline |
| PubChem CID | 5246559 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinazoline |
| SMILES | c1ccc2c(c1)CNCN2 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-4,9-10H,5-6H2 |
| InChIKey | PKORYTIUMAOPED-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,3,4-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetrahydroquinazoline?
The IUPAC name of 1,2,3,4-tetrahydroquinazoline (CID 5246559) is 1,2,3,4-tetrahydroquinazoline.
What is the SMILES notation for 1,2,3,4-tetrahydroquinazoline?
The canonical SMILES for 1,2,3,4-tetrahydroquinazoline is c1ccc2c(c1)CNCN2.
What is the InChIKey of 1,2,3,4-tetrahydroquinazoline?
The InChIKey is PKORYTIUMAOPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-9-6-10-8/h1-4,9-10H,5-6H2.
What are the key properties of 1,2,3,4-tetrahydroquinazoline?
1,2,3,4-tetrahydroquinazoline has a molecular weight of 134.18 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetrahydroquinazoline is sourced from PubChem (CID 5246559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).