C28H32O8 — CID 5247708
1,6,9,21-tetramethyl-7,11,19,23,24,28-hexaoxapentacyclo[19.2.2.22,5.26,9.113,17]triaconta-2(30),3,5(29),13,15,17(26)-hexaene-12,18-dione (PubChem CID 5247708) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is 1,6,9,21-tetramethyl-7,11,19,23,24,28-hexaoxapentacyclo[19.2.2.22,5.26,9.113,17]triaconta-2(30),3,5(29),13,15,17(26)-hexaene-12,18-dione.
| Compound Name | 1,6,9,21-tetramethyl-7,11,19,23,24,28-hexaoxapentacyclo[19.2.2.22,5.26,9.113,17]triaconta-2(30),3,5(29),13,15,17(26)-hexaene-12,18-dione |
|---|---|
| PubChem CID | 5247708 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 1,6,9,21-tetramethyl-7,11,19,23,24,28-hexaoxapentacyclo[19.2.2.22,5.26,9.113,17]triaconta-2(30),3,5(29),13,15,17(26)-hexaene-12,18-dione |
| SMILES | CC12COC(=O)c3cccc(c3)C(=O)OCC3(C)COC(C)(OC3)c3ccc(cc3)C(C)(OC1)OC2 |
| InChI | InChI=1S/C28H32O8/c1-25-13-31-23(29)19-6-5-7-20(12-19)24(30)32-14-26(2)17-35-28(4,36-18-26)22-10-8-21(9-11-22)27(3,33-15-25)34-16-25/h5-12H,13-18H2,1-4H3 |
| InChIKey | RVWAALULQXYPGA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |