C5H12N2O2 — CID 5247804
5-methyl-1,3-diazinane-2,4-diol (PubChem CID 5247804) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 5-methyl-1,3-diazinane-2,4-diol.
| Compound Name | 5-methyl-1,3-diazinane-2,4-diol |
|---|---|
| PubChem CID | 5247804 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 5-methyl-1,3-diazinane-2,4-diol |
| SMILES | CC1CNC(O)NC1O |
| InChI | InChI=1S/C5H12N2O2/c1-3-2-6-5(9)7-4(3)8/h3-9H,2H2,1H3 |
| InChIKey | CAFYZJKSBAQKTJ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |