About 5-methyl-1,3-diazinane-2,4-diol
5-methyl-1,3-diazinane-2,4-diol (PubChem CID 5247804) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 5-methyl-1,3-diazinane-2,4-diol.
Molecular Properties
| Compound Name | 5-methyl-1,3-diazinane-2,4-diol |
| PubChem CID | 5247804 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 5-methyl-1,3-diazinane-2,4-diol |
| SMILES | CC1CNC(O)NC1O |
| InChI | InChI=1S/C5H12N2O2/c1-3-2-6-5(9)7-4(3)8/h3-9H,2H2,1H3 |
| InChIKey | CAFYZJKSBAQKTJ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-1,3-diazinane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3-diazinane-2,4-diol?
The IUPAC name of 5-methyl-1,3-diazinane-2,4-diol (CID 5247804) is 5-methyl-1,3-diazinane-2,4-diol.
What is the SMILES notation for 5-methyl-1,3-diazinane-2,4-diol?
The canonical SMILES for 5-methyl-1,3-diazinane-2,4-diol is CC1CNC(O)NC1O.
What is the InChIKey of 5-methyl-1,3-diazinane-2,4-diol?
The InChIKey is CAFYZJKSBAQKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-3-2-6-5(9)7-4(3)8/h3-9H,2H2,1H3.
What are the key properties of 5-methyl-1,3-diazinane-2,4-diol?
5-methyl-1,3-diazinane-2,4-diol has a molecular weight of 132.16 g/mol, XLogP of -1.59, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3-diazinane-2,4-diol is sourced from PubChem (CID 5247804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).