C6H13NO — CID 163490256
4,5-dimethylpyrrolidin-2-ol (PubChem CID 163490256) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is 4,5-dimethylpyrrolidin-2-ol.
| Compound Name | 4,5-dimethylpyrrolidin-2-ol |
|---|---|
| PubChem CID | 163490256 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 4,5-dimethylpyrrolidin-2-ol |
| SMILES | CC1CC(O)NC1C |
| InChI | InChI=1S/C6H13NO/c1-4-3-6(8)7-5(4)2/h4-8H,3H2,1-2H3 |
| InChIKey | CLZNFRMLVXGOOL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |