C12H24N2 — CID 159572720
2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,8-naphthyridine (PubChem CID 159572720) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,8-naphthyridine.
| Compound Name | 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 159572720 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2,3,6,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydro-1,8-naphthyridine |
| SMILES | CC1CC2CC(C)C(C)NC2NC1C |
| InChI | InChI=1S/C12H24N2/c1-7-5-11-6-8(2)10(4)14-12(11)13-9(7)3/h7-14H,5-6H2,1-4H3 |
| InChIKey | PUYRUSPCOBBIMF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |