2-hydroxybutanedioic acid

C4H6O5 — CID 525

IUPAC2-hydroxybutanedioic acid
SMILESO=C(O)CC(O)C(=O)O
InChIInChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyBJEPYKJPYRNKOW-UHFFFAOYSA-N
MW134.09 g/mol
LogP-1.09
Rot. Bonds3

About 2-hydroxybutanedioic acid

2-hydroxybutanedioic acid (PubChem CID 525) has the molecular formula C4H6O5 and a molecular weight of 134.09 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid.

Molecular Properties

Compound Name2-hydroxybutanedioic acid
PubChem CID525
Molecular FormulaC4H6O5
Molecular Weight134.09 g/mol
Exact Mass134.02
IUPAC Name2-hydroxybutanedioic acid
SMILESO=C(O)CC(O)C(=O)O
InChIInChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)
InChIKeyBJEPYKJPYRNKOW-UHFFFAOYSA-N
XLogP-1.09
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.09
LogP ≤ 5-1.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-hydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxybutanedioic acid?
The IUPAC name of 2-hydroxybutanedioic acid (CID 525) is 2-hydroxybutanedioic acid.
What is the SMILES notation for 2-hydroxybutanedioic acid?
The canonical SMILES for 2-hydroxybutanedioic acid is O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanedioic acid?
The InChIKey is BJEPYKJPYRNKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-hydroxybutanedioic acid?
2-hydroxybutanedioic acid has a molecular weight of 134.09 g/mol, XLogP of -1.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid is sourced from PubChem (CID 525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).