About 2-hydroxybutanedioic acid
2-hydroxybutanedioic acid (PubChem CID 525) has the molecular formula C4H6O5
and a molecular weight of 134.09 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | 2-hydroxybutanedioic acid |
| PubChem CID | 525 |
| Molecular Formula | C4H6O5 |
| Molecular Weight | 134.09 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | BJEPYKJPYRNKOW-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.09 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioic acid?
The IUPAC name of 2-hydroxybutanedioic acid (CID 525) is 2-hydroxybutanedioic acid.
What is the SMILES notation for 2-hydroxybutanedioic acid?
The canonical SMILES for 2-hydroxybutanedioic acid is O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanedioic acid?
The InChIKey is BJEPYKJPYRNKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9).
What are the key properties of 2-hydroxybutanedioic acid?
2-hydroxybutanedioic acid has a molecular weight of 134.09 g/mol, XLogP of -1.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid is sourced from PubChem (CID 525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).