C16H14ClN3O3 — CID 52505874
4-[[(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]amino]-3-nitrobenzamide (PubChem CID 52505874) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 4-[[(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]amino]-3-nitrobenzamide.
| Compound Name | 4-[[(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 52505874 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-[[(1R)-4-chloro-2,3-dihydro-1H-inden-1-yl]amino]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(N[C@@H]2CCc3c(Cl)cccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14ClN3O3/c17-12-3-1-2-11-10(12)5-7-13(11)19-14-6-4-9(16(18)21)8-15(14)20(22)23/h1-4,6,8,13,19H,5,7H2,(H2,18,21)/t13-/m1/s1 |
| InChIKey | IGLDFXMDDZYLIX-CYBMUJFWSA-N |
| XLogP | 3.45 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|