About azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum
azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum (PubChem CID 5250594) has the molecular formula C7H10Cl4N2Pt-2
and a molecular weight of 459.06 g/mol. Its IUPAC name is azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum.
Molecular Properties
| Compound Name | azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum |
| PubChem CID | 5250594 |
| Molecular Formula | C7H10Cl4N2Pt-2 |
| Molecular Weight | 459.06 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum |
| SMILES | Cc1cc[c-]cc1N.Cl[Pt](Cl)(Cl)Cl.[NH2-] |
| InChI | InChI=1S/C7H8N.4ClH.H2N.Pt/c1-6-4-2-3-5-7(6)8;;;;;;/h2,4-5H,8H2,1H3;4*1H;1H2;/q-1;;;;;-1;+4/p-4 |
| InChIKey | CSIYINHLGHFQEZ-UHFFFAOYSA-J |
| XLogP | 4.85 |
| TPSA | 59.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.06 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum?
The IUPAC name of azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum (CID 5250594) is azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum.
What is the SMILES notation for azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum?
The canonical SMILES for azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum is Cc1cc[c-]cc1N.Cl[Pt](Cl)(Cl)Cl.[NH2-].
What is the InChIKey of azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum?
The InChIKey is CSIYINHLGHFQEZ-UHFFFAOYSA-J. The full InChI is InChI=1S/C7H8N.4ClH.H2N.Pt/c1-6-4-2-3-5-7(6)8;;;;;;/h2,4-5H,8H2,1H3;4*1H;1H2;/q-1;;;;;-1;+4/p-4.
What are the key properties of azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum?
azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum has a molecular weight of 459.06 g/mol, XLogP of 4.85, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;2-methylbenzene-5-id-1-amine;tetrachloroplatinum is sourced from PubChem (CID 5250594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).