About 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium)
6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) (PubChem CID 58729657) has the molecular formula C12H11Y2-
and a molecular weight of 333.03 g/mol. Its IUPAC name is 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium).
Molecular Properties
| Compound Name | 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) |
| PubChem CID | 58729657 |
| Molecular Formula | C12H11Y2- |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) |
| SMILES | Cc1cc2c[c-]ccc2cc1C.[Y].[Y] |
| InChI | InChI=1S/C12H11.2Y/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;;/h3,5-8H,1-2H3;;/q-1;; |
| InChIKey | PEQJRPPHQUMISL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium)?
The IUPAC name of 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) (CID 58729657) is 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium).
What is the SMILES notation for 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium)?
The canonical SMILES for 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) is Cc1cc2c[c-]ccc2cc1C.[Y].[Y].
What is the InChIKey of 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium)?
The InChIKey is PEQJRPPHQUMISL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11.2Y/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;;/h3,5-8H,1-2H3;;/q-1;;.
What are the key properties of 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium)?
6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) has a molecular weight of 333.03 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2H-naphthalen-2-ide;bis(yttrium) is sourced from PubChem (CID 58729657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).