C22H21NO2S — CID 5250776
N-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)benzenesulfonamide (PubChem CID 5250776) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)benzenesulfonamide.
| Compound Name | N-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5250776 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc2ccc1CCc1ccc(cc1)CC2)c1ccccc1 |
| InChI | InChI=1S/C22H21NO2S/c24-26(25,21-4-2-1-3-5-21)23-22-16-19-11-10-17-6-8-18(9-7-17)12-14-20(22)15-13-19/h1-9,13,15-16,23H,10-12,14H2 |
| InChIKey | VBUNTWGPIMFNTD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |