C18H21N3O3S3 — CID 52513231
N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide (PubChem CID 52513231) has the molecular formula C18H21N3O3S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 52513231 |
| Molecular Formula | C18H21N3O3S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-2-(thiophen-2-ylmethylsulfanyl)acetamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)CSCc2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3O3S3/c1-21-10-2-5-17(21)20-27(23,24)16-8-6-14(7-9-16)19-18(22)13-25-12-15-4-3-11-26-15/h3-4,6-9,11H,2,5,10,12-13H2,1H3,(H,19,22) |
| InChIKey | IZDFIQSBJJUACK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|