C23H36N4O3 — CID 52513677
1-[(1R)-1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 52513677) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-[(1R)-1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 52513677 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-[(1R)-1-(3,4-diethoxyphenyl)-2-methylpropyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | CCOc1ccc([C@H](NC(=O)NCCCn2nc(C)cc2C)C(C)C)cc1OCC |
| InChI | InChI=1S/C23H36N4O3/c1-7-29-20-11-10-19(15-21(20)30-8-2)22(16(3)4)25-23(28)24-12-9-13-27-18(6)14-17(5)26-27/h10-11,14-16,22H,7-9,12-13H2,1-6H3,(H2,24,25,28)/t22-/m1/s1 |
| InChIKey | GEMYTEZCDKBDPV-JOCHJYFZSA-N |
| XLogP | 4.38 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|