C22H27NO4 — CID 52522411
3-methoxy-N-[(R)-[(2S)-oxolan-2-yl]-phenylmethyl]-4-propan-2-yloxybenzamide (PubChem CID 52522411) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-methoxy-N-[(R)-[(2S)-oxolan-2-yl]-phenylmethyl]-4-propan-2-yloxybenzamide.
| Compound Name | 3-methoxy-N-[(R)-[(2S)-oxolan-2-yl]-phenylmethyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 52522411 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3-methoxy-N-[(R)-[(2S)-oxolan-2-yl]-phenylmethyl]-4-propan-2-yloxybenzamide |
| SMILES | COc1cc(C(=O)N[C@H](c2ccccc2)[C@@H]2CCCO2)ccc1OC(C)C |
| InChI | InChI=1S/C22H27NO4/c1-15(2)27-18-12-11-17(14-20(18)25-3)22(24)23-21(19-10-7-13-26-19)16-8-5-4-6-9-16/h4-6,8-9,11-12,14-15,19,21H,7,10,13H2,1-3H3,(H,23,24)/t19-,21+/m0/s1 |
| InChIKey | OSCHJUPTGACWMN-PZJWPPBQSA-N |
| XLogP | 4.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |