C21H17F3N2O4 — CID 52533141
(5S)-5-(1-benzofuran-2-yl)-5-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 52533141) has the molecular formula C21H17F3N2O4 and a molecular weight of 418.37 g/mol. Its IUPAC name is (5S)-5-(1-benzofuran-2-yl)-5-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1-benzofuran-2-yl)-5-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52533141 |
| Molecular Formula | C21H17F3N2O4 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (5S)-5-(1-benzofuran-2-yl)-5-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2cc3ccccc3o2)NC(=O)N(Cc2cccc(OCC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H17F3N2O4/c1-20(17-10-14-6-2-3-8-16(14)30-17)18(27)26(19(28)25-20)11-13-5-4-7-15(9-13)29-12-21(22,23)24/h2-10H,11-12H2,1H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | LQUSJWZCGKPCIQ-FQEVSTJZSA-N |
| XLogP | 4.34 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|