C20H17BrN2O4 — CID 55442400
5-(1-benzofuran-2-yl)-3-[(5-bromo-2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 55442400) has the molecular formula C20H17BrN2O4 and a molecular weight of 429.27 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-3-[(5-bromo-2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1-benzofuran-2-yl)-3-[(5-bromo-2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55442400 |
| Molecular Formula | C20H17BrN2O4 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-3-[(5-bromo-2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(Br)cc1CN1C(=O)NC(C)(c2cc3ccccc3o2)C1=O |
| InChI | InChI=1S/C20H17BrN2O4/c1-20(17-10-12-5-3-4-6-16(12)27-17)18(24)23(19(25)22-20)11-13-9-14(21)7-8-15(13)26-2/h3-10H,11H2,1-2H3,(H,22,25) |
| InChIKey | ONZOYHHMJDPBSN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|