C20H21N3O4 — CID 52535579
N-[(2S)-1-[[(1R)-2,3-dihydro-1H-inden-1-yl]-methylamino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 52535579) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R)-2,3-dihydro-1H-inden-1-yl]-methylamino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[(2S)-1-[[(1R)-2,3-dihydro-1H-inden-1-yl]-methylamino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 52535579 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(2S)-1-[[(1R)-2,3-dihydro-1H-inden-1-yl]-methylamino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | C[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N(C)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C20H21N3O4/c1-13(21-19(24)15-7-5-8-16(12-15)23(26)27)20(25)22(2)18-11-10-14-6-3-4-9-17(14)18/h3-9,12-13,18H,10-11H2,1-2H3,(H,21,24)/t13-,18+/m0/s1 |
| InChIKey | KAFWQVMBCYOQJE-SCLBCKFNSA-N |
| XLogP | 2.86 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|