C23H19F3N2O3 — CID 52537687
(5R)-3-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 52537687) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is (5R)-3-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52537687 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (5R)-3-[(2R)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(C[C@H](O)c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C23H19F3N2O3/c1-22(16-11-10-14-6-2-3-7-15(14)12-16)20(30)28(21(31)27-22)13-19(29)17-8-4-5-9-18(17)23(24,25)26/h2-12,19,29H,13H2,1H3,(H,27,31)/t19-,22+/m0/s1 |
| InChIKey | DBRDZSPJDUCMIN-SIKLNZKXSA-N |
| XLogP | 4.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|