C34H38F6N2O3 — CID 89151975
3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenyl]pentyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 89151975) has the molecular formula C34H38F6N2O3 and a molecular weight of 636.68 g/mol. Its IUPAC name is 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenyl]pentyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenyl]pentyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89151975 |
| Molecular Formula | C34H38F6N2O3 |
| Molecular Weight | 636.68 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenyl]pentyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1CCCCCN1C(=O)NC(C)(c2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C34H38F6N2O3/c1-4-11-24-20-27(32(45,33(35,36)37)34(38,39)40)21-25(12-5-2)28(24)15-7-6-10-18-42-29(43)31(3,41-30(42)44)26-17-16-22-13-8-9-14-23(22)19-26/h8-9,13-14,16-17,19-21,45H,4-7,10-12,15,18H2,1-3H3,(H,41,44) |
| InChIKey | SHGHDRNWPOXKGG-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|