About 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine
4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine (PubChem CID 5255482) has the molecular formula C18H33N3S2
and a molecular weight of 355.62 g/mol. Its IUPAC name is 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine |
| PubChem CID | 5255482 |
| Molecular Formula | C18H33N3S2 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine |
| SMILES | C1CCC(C2CC(C3CSSC3)CC(C3CCCCN3)N2)NC1 |
| InChI | InChI=1S/C18H33N3S2/c1-3-7-19-15(5-1)17-9-13(14-11-22-23-12-14)10-18(21-17)16-6-2-4-8-20-16/h13-21H,1-12H2 |
| InChIKey | DFFROPFLDFYPME-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine?
The IUPAC name of 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine (CID 5255482) is 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine.
What is the SMILES notation for 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine?
The canonical SMILES for 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine is C1CCC(C2CC(C3CSSC3)CC(C3CCCCN3)N2)NC1.
What is the InChIKey of 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine?
The InChIKey is DFFROPFLDFYPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3S2/c1-3-7-19-15(5-1)17-9-13(14-11-22-23-12-14)10-18(21-17)16-6-2-4-8-20-16/h13-21H,1-12H2.
What are the key properties of 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine?
4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine has a molecular weight of 355.62 g/mol, XLogP of 3.02, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dithiolan-4-yl)-2,6-di(piperidin-2-yl)piperidine is sourced from PubChem (CID 5255482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).